notAcalculator logo

pH Calculator

pH Calculator

Give us your feedback! Was this useful?

Introduction

The pH scale is one of the most widely used measurements in chemistry, biology, environmental science, and medicine. It quantifies how acidic or basic (alkaline) a solution is on a logarithmic scale ranging from 0 to 14, with 7 representing neutrality. The term pH stands for "potential of hydrogen" and refers to the concentration of hydrogen ions (H⁺) in solution. Because the scale is logarithmic, each whole pH unit represents a tenfold change in hydrogen ion concentration — a solution with pH 3 is ten times more acidic than one with pH 4, and a hundred times more acidic than pH 5.

The pH scale was introduced by Danish chemist Søren Peder Lauritz Sørensen in 1909 while studying the effect of hydrogen ion concentration on enzyme activity in brewing. His original formulation used the negative logarithm of the hydrogen ion concentration, a convention that remains standard more than a century later. Today, pH measurement is essential across countless applications: from ensuring safe drinking water and maintaining swimming pool chemistry, to optimizing soil conditions for agriculture and diagnosing medical conditions through blood pH analysis.

This pH Calculator allows you to convert between pH, pOH, and hydrogen or hydroxide ion concentrations. It also classifies your solution as acidic, basic, or neutral based on the calculated pH value.

pH work connects to the other chemistry tools on this site. The Molarity Calculator prepares solutions of exact concentration, which determines their hydrogen ion concentration, while the Molecular Weight Calculator converts between the mass and moles needed for those solutions. The Density Calculator relates mass and volume for solution preparation, and the Half-Life Calculator models the decay kinetics relevant to acid-base and radioactive chemistry.

[iupac-ph]

How to Use

The calculator offers three modes depending on what information you have.

Mode 1: pH from [H⁺] Concentration. If you know the hydrogen ion concentration of your solution, enter it in moles per liter (M). The calculator computes the pH using the fundamental formula and classifies the result. For example, a solution with [H⁺] = 0.001 M (1 × 10⁻³ M) produces a pH of 3.00, which is classified as acidic. A solution with [H⁺] = 1 × 10⁻⁸ M produces a pH of 8.00, classified as basic.

Mode 2: [H⁺] Concentration from pH. If you know the pH value, enter it on the 0-14 scale. The calculator determines the corresponding hydrogen ion concentration in moles per liter. For instance, a pH of 4.5 gives [H⁺] = 3.16 × 10⁻⁵ M, while a pH of 10.2 gives [H⁺] = 6.31 × 10⁻¹¹ M.

Mode 3: pH and pOH. Enter a pH value to receive the full set of derived quantities: pOH, hydrogen ion concentration, and hydroxide ion concentration. The relationship pH + pOH = 14 (at 25°C) always holds for aqueous solutions, so knowing one gives you the other.

Example Calculations

Example 1: Strong Acid. Calculate the pH of a 0.01 M hydrochloric acid (HCl) solution. Hydrochloric acid is a strong acid that dissociates completely, so [H⁺] = 0.01 M.

pH=log10[H+]=log10(0.01)=2.00pH = -\log_{10}[H^{+}] = -\log_{10}(0.01) = 2.00

A pH of 2.00 indicates a strongly acidic solution. For comparison, lemon juice typically has a pH around 2.2, and stomach acid ranges from 1.5 to 3.5.

Example 2: Strong Base. Calculate the pH of a 0.001 M sodium hydroxide (NaOH) solution. NaOH dissociates completely to give [OH⁻] = 0.001 M.

pOH=log10[OH]=log10(0.001)=3.00pOH = -\log_{10}[OH^{-}] = -\log_{10}(0.001) = 3.00
pH=14.00pOH=14.003.00=11.00pH = 14.00 - pOH = 14.00 - 3.00 = 11.00

A pH of 11.00 indicates a moderately basic solution, similar to household ammonia cleaning products.

Example 3: Hydrogen Ion Concentration from pH. The pH of a sample of rainwater is measured at 5.6. Calculate the hydrogen ion concentration.

[H+]=10pH=105.6=2.51×106 M[H^{+}] = 10^{-pH} = 10^{-5.6} = 2.51 \times 10^{-6} \text{ M}

This slightly acidic pH in rainwater is primarily caused by dissolved carbon dioxide from the atmosphere, which forms carbonic acid (H₂CO₃). Natural rainwater typically ranges from pH 5.0 to 5.6 due to this effect, while the lower pH values associated with acid rain (below 5.0) result from additional pollutants like sulfur dioxide and nitrogen oxides.

[usgs-ph]

pH in Everyday Context

The pH scale has practical applications far beyond the chemistry laboratory. In agriculture, soil pH directly affects nutrient availability and crop yield, with most vegetables thriving in the slightly acidic to neutral range of 6.0 to 7.0. In aquariums and fishkeeping, pH monitoring is essential because most freshwater fish require stable pH in the 6.5-8.0 range, and sudden pH shifts can be fatal. In food preservation, pH determines the safety of canned goods through the acidity requirements for pressure canning versus water bath canning. In human health, blood pH is tightly regulated between 7.35 and 7.45, and deviations beyond this range indicate metabolic or respiratory disorders requiring medical attention.

[usgs-ph]

The Formula

The pH of a solution is defined as the negative base-10 logarithm of the hydrogen ion activity. In practice, activity is approximated by concentration for dilute solutions.

pH=log10[H+]pH = -\log_{10}[H^{+}]
[iupac-ph]

Where [H⁺] is the hydrogen ion concentration in moles per liter (M). The pOH follows from the water dissociation constant (K_w):

pOH=log10[OH]pOH = -\log_{10}[OH^{-}]

At 25°C (standard laboratory temperature), the ion product of water is:

Kw=[H+][OH]=1.0×1014K_w = [H^{+}][OH^{-}] = 1.0 \times 10^{-14}

This leads to the fundamental relationship:

pH+pOH=14.00pH + pOH = 14.00

To convert from pH back to hydrogen ion concentration:

[H+]=10pH[H^{+}] = 10^{-pH}

And similarly for hydroxide ions:

[OH]=10pOH[OH^{-}] = 10^{-pOH}
[chemlibre-ph]

The pH Scale Reference Table

The following table shows common substances and their approximate pH values, organized from most acidic to most basic.

pH RangeClassificationExample Substances
0-1Strongly AcidicBattery acid (0), stomach acid (1)
2-3Moderately AcidicLemon juice (2.2), vinegar (2.8)
4-5Weakly AcidicCoffee (5.0), rain water (5.6)
6Very Weakly AcidicMilk (6.5), pure water (7.0 at 25°C)
7NeutralPure distilled water
8-9Weakly BasicSea water (8.1), baking soda solution (8.4)
10-11Moderately BasicMilk of magnesia (10.5), ammonia solution (11.1)
12-14Strongly BasicBleach (12.6), drain cleaner (14.0)
pH values of common substances along the 0-14 scale
[nist-ph]

Practical Tips

When measuring or calculating pH, keep these important considerations in mind.

Temperature matters. The neutral point of water (pH 7.00) is only valid at 25°C (77°F). As temperature increases, the ion product of water (K_w) increases, shifting the neutral pH. At 0°C, neutral pH is approximately 7.47; at 100°C, it drops to about 6.14. Always note the temperature when interpreting pH measurements. Many pH meters include automatic temperature compensation (ATC) that adjusts for this effect.

Strong vs. weak acids and bases. This calculator assumes complete dissociation for strong acids and bases. For weak acids and bases, the actual [H⁺] depends on the acid dissociation constant (K_a) and requires the Henderson-Hasselbalch equation for buffer solutions. The simple pH = -log[H⁺] formula assumes that the acid or base has fully dissociated.

Concentration vs. activity. In solutions with high ionic strength (concentrated salt solutions), the activity of hydrogen ions differs from their concentration. Standard pH measurements using a glass electrode actually measure activity, not concentration. For most dilute solutions (below 0.1 M), the difference is negligible.

Buffer solutions resist pH change. Buffer solutions contain a weak acid and its conjugate base (or a weak base and its conjugate acid). They resist pH changes when small amounts of acid or base are added. Common buffers include phosphate-buffered saline (PBS) used in biological research and carbonate buffers in seawater. The Henderson-Hasselbalch equation describes buffer pH: pH = pK_a + log([A⁻]/[HA]).

pH measurement methods. The two most common approaches to measuring pH are pH meters and indicator papers. Colorimetric pH test strips remain widely used in applications requiring portability and low cost, such as pool maintenance and soil testing, where their typical 0.5 unit resolution is adequate. For laboratory applications requiring precision, glass electrode pH meters achieve 0.01 unit accuracy when properly maintained and calibrated. pH meters use a glass electrode that generates a voltage proportional to hydrogen ion activity, providing readings accurate to 0.01 pH units when properly calibrated with standard buffer solutions. Litmus paper and universal indicator strips offer a simpler, less expensive alternative with approximately 0.5 pH unit accuracy, suitable for quick checks in soil testing, pool maintenance, and educational settings. For high-precision laboratory work, pH meters are preferred and should be calibrated daily using at least two buffer solutions spanning the expected measurement range.

pH in biological systems. Living organisms maintain strict pH homeostasis because enzyme activity, membrane transport, and cellular metabolism are highly pH-dependent. Human blood is buffered primarily by the carbonic acid-bicarbonate system (pK_a = 6.1), with a normal pH range of 7.35-7.45. The stomach maintains a highly acidic environment (pH 1.5-3.5) for protein digestion and pathogen destruction via specialized parietal cells that secrete hydrochloric acid. In contrast, the small intestine requires a near-neutral pH (6.0-7.5) for optimal pancreatic enzyme function, achieved through bicarbonate secretion from the pancreas.

[acs-ph]

Limitations

This calculator uses the simplified relationship pH = -log₁₀[H⁺], which assumes ideal behavior and complete dissociation. It does not account for temperature effects on the ion product of water, activity coefficients in concentrated solutions, or the partial dissociation of weak acids and bases. For buffer solutions or multi-component systems, more sophisticated models incorporating the Henderson-Hasselbalch equation or Debye-Hückel theory are required. The pH scale is typically considered to range from 0 to 14 in aqueous solutions, though concentrated strong acids or bases can produce values outside this range. Users working with non-aqueous solvents should note that the pH scale and the ion product of water do not apply in the same way for solvents other than water.

Frequently Asked Questions

What does pH stand for?
pH stands for 'potential of hydrogen' (from Latin 'potentia hydrogenii'). It was first proposed by Danish chemist S.P.L. Sørensen in 1909 to express hydrogen ion concentration on a convenient logarithmic scale. The p in pH can also be thought of as denoting the negative logarithm (power) of the hydrogen ion concentration.
Why is the pH scale 0 to 14?
The scale arises from the ion product of water (K_w = 1.0 × 10⁻¹⁴ at 25°C). A 1 M solution of a strong acid gives [H⁺] = 1 M, producing pH = 0. A 1 M solution of a strong base gives [OH⁻] = 1 M, producing [H⁺] = 10⁻¹⁴ M and pH = 14. Extremely concentrated acids or bases can produce pH values below 0 or above 14.
What is the difference between pH and pOH?
pH measures hydrogen ion concentration while pOH measures hydroxide ion concentration. They are related by the equation pH + pOH = 14.00 at 25°C. This means a solution with pH 7 has pOH 7 (neutral), while a solution with pH 3 has pOH 11 (acidic).
Can pH be negative?
Yes. Concentrated strong acids (above 1 M) can have negative pH values. For example, 2 M HCl produces [H⁺] = 2 M, giving pH = -₁₀log(2) = -0.30. However, at such high concentrations, activity coefficients deviate significantly from 1, making the simple formula less accurate. Most pH meters are calibrated for the 0-14 range.
What is the pH of pure water?
Pure distilled water at 25°C has exactly pH 7.00. However, pure water is extremely reactive to atmospheric CO₂ — it quickly absorbs carbon dioxide from the air, forming carbonic acid and lowering the pH to about 5.5-6.0. This is why freshly distilled water must be stored in airtight containers to maintain neutral pH. At different temperatures, neutral pH shifts (7.47 at 0°C, 6.14 at 100°C).
What pH range is safe for drinking water?
According to the EPA, the recommended pH range for drinking water is 6.5 to 8.5. Water outside this range may indicate contamination or pipe corrosion. Low pH water can leach metals like lead and copper from plumbing, while high pH water can have a bitter taste and cause scale buildup. The USGS notes that most natural water bodies have pH between 6.0 and 8.5.
How does temperature affect pH measurements?
Temperature affects both the ion product of water (K_w) and the response of pH electrodes. The neutral pH shifts from 7.47 at 0°C to 6.14 at 100°C. Most modern pH meters include automatic temperature compensation (ATC) using a built-in temperature probe. Always allow your solution to reach a stable temperature before measuring, and never store pH electrodes in distilled water as it damages the glass membrane.
What is a buffer solution?
A buffer solution resists changes in pH when small amounts of acid or base are added. It consists of a weak acid and its conjugate base (or a weak base and its conjugate acid). The Henderson-Hasselbalch equation describes buffer behavior: pH = pKₐ + log([A⁻]/[HA]). Common biological buffers include phosphate-buffered saline (PBS, pH 7.4), Tris (pH 8.0), and HEPES (pH 7.5).
How do I measure pH in soil?
Soil pH measurement typically involves mixing a soil sample with distilled water (1:1 ratio), allowing it to settle, and then testing the supernatant liquid with a pH meter or test strips. Most garden vegetables prefer slightly acidic soil (pH 6.0-7.0), while blueberries and azaleas require more acidic conditions (pH 4.5-5.5). Lime is commonly added to raise soil pH, while sulfur or aluminum sulfate lowers it. The USDA Natural Resources Conservation Service provides regional soil pH maps through its Web Soil Survey.
What is the difference between a strong acid and a weak acid?
A strong acid (like HCl or H₂SO₄) dissociates completely in water, meaning every acid molecule releases its hydrogen ion. A weak acid (like acetic acid CH₃COOH) only partially dissociates, establishing an equilibrium between the undissociated acid and its ions. This means the actual [H⁺] for a weak acid is lower than the nominal concentration, and calculating its pH requires the acid dissociation constant (Kₐ) rather than the simple pH = -log[H⁺] formula. The Henderson-Hasselbalch equation is used for buffer solutions containing weak acids and their conjugate bases.

References

  1. [1]NIST. pH Measurement and Standards.
  2. [2]International Union of Pure and Applied Chemistry. pH Definition. IUPAC Gold Book.
  3. [3]U.S. Geological Survey. pH and Water Quality.
  4. [4]LibreTexts Chemistry. The pH Scale.
  5. [5]American Chemical Society. Acids, Bases, and the pH Scale.
  6. [6]Boyle, J. & Senior, K. Acids, Bases, and pH: A Guide for Students. Royal Society of Chemistry.

Last updated: August 2, 2026

1b

UnByte — Independent Software Engineering

Every calculator references authoritative sources — Editorial policy